C14H7Cl2FN2S — CID 79438292
4,6-dichloro-5-(4-fluorophenyl)-2-thiophen-3-ylpyrimidine (PubChem CID 79438292) has the molecular formula C14H7Cl2FN2S and a molecular weight of 325.20 g/mol. Its IUPAC name is 4,6-dichloro-5-(4-fluorophenyl)-2-thiophen-3-ylpyrimidine.
| Compound Name | 4,6-dichloro-5-(4-fluorophenyl)-2-thiophen-3-ylpyrimidine |
|---|---|
| PubChem CID | 79438292 |
| Molecular Formula | C14H7Cl2FN2S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4,6-dichloro-5-(4-fluorophenyl)-2-thiophen-3-ylpyrimidine |
| SMILES | Fc1ccc(-c2c(Cl)nc(-c3ccsc3)nc2Cl)cc1 |
| InChI | InChI=1S/C14H7Cl2FN2S/c15-12-11(8-1-3-10(17)4-2-8)13(16)19-14(18-12)9-5-6-20-7-9/h1-7H |
| InChIKey | GFFYQSKFONJLJC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |