About 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate
3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate (PubChem CID 7943833) has the molecular formula C19H17N2O4-
and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate.
Molecular Properties
| Compound Name | 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate |
| PubChem CID | 7943833 |
| Molecular Formula | C19H17N2O4- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate |
| SMILES | Cc1cccc(C)c1N1C(=O)C[C@@H](Nc2cccc(C(=O)[O-])c2)C1=O |
| InChI | InChI=1S/C19H18N2O4/c1-11-5-3-6-12(2)17(11)21-16(22)10-15(18(21)23)20-14-8-4-7-13(9-14)19(24)25/h3-9,15,20H,10H2,1-2H3,(H,24,25)/p-1/t15-/m1/s1 |
| InChIKey | MVFDZNVUKHIEGQ-OAHLLOKOSA-M |
| XLogP | 1.41 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The IUPAC name of 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate (CID 7943833) is 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate.
What is the SMILES notation for 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The canonical SMILES for 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate is Cc1cccc(C)c1N1C(=O)C[C@@H](Nc2cccc(C(=O)[O-])c2)C1=O.
What is the InChIKey of 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The InChIKey is MVFDZNVUKHIEGQ-OAHLLOKOSA-M. The full InChI is InChI=1S/C19H18N2O4/c1-11-5-3-6-12(2)17(11)21-16(22)10-15(18(21)23)20-14-8-4-7-13(9-14)19(24)25/h3-9,15,20H,10H2,1-2H3,(H,24,25)/p-1/t15-/m1/s1.
What are the key properties of 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate has a molecular weight of 337.36 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate is sourced from PubChem (CID 7943833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).