C14H15FN2O2S — CID 79438848
5-(2-fluorophenyl)-4-hydroxy-2-(propylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 79438848) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-hydroxy-2-(propylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(2-fluorophenyl)-4-hydroxy-2-(propylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79438848 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-(2-fluorophenyl)-4-hydroxy-2-(propylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CCCSCc1nc(O)c(-c2ccccc2F)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-2-7-20-8-11-16-13(18)12(14(19)17-11)9-5-3-4-6-10(9)15/h3-6H,2,7-8H2,1H3,(H2,16,17,18,19) |
| InChIKey | PLJBKXONJILZLE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|