C15H11Br2FO2 — CID 79438919
3-(4-bromo-2-fluorophenyl)-2-(2-bromophenyl)propanoic acid (PubChem CID 79438919) has the molecular formula C15H11Br2FO2 and a molecular weight of 402.06 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-2-(2-bromophenyl)propanoic acid.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-2-(2-bromophenyl)propanoic acid |
|---|---|
| PubChem CID | 79438919 |
| Molecular Formula | C15H11Br2FO2 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-2-(2-bromophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Br)cc1F)c1ccccc1Br |
| InChI | InChI=1S/C15H11Br2FO2/c16-10-6-5-9(14(18)8-10)7-12(15(19)20)11-3-1-2-4-13(11)17/h1-6,8,12H,7H2,(H,19,20) |
| InChIKey | FUPAZSUBKZFJNI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |