About 5-(2-bromophenyl)-4,6-dichloropyrimidine
5-(2-bromophenyl)-4,6-dichloropyrimidine (PubChem CID 79439430) has the molecular formula C10H5BrCl2N2
and a molecular weight of 303.97 g/mol. Its IUPAC name is 5-(2-bromophenyl)-4,6-dichloropyrimidine.
Molecular Properties
| Compound Name | 5-(2-bromophenyl)-4,6-dichloropyrimidine |
| PubChem CID | 79439430 |
| Molecular Formula | C10H5BrCl2N2 |
| Molecular Weight | 303.97 g/mol |
| Exact Mass | 301.90 |
| IUPAC Name | 5-(2-bromophenyl)-4,6-dichloropyrimidine |
| SMILES | Clc1ncnc(Cl)c1-c1ccccc1Br |
| InChI | InChI=1S/C10H5BrCl2N2/c11-7-4-2-1-3-6(7)8-9(12)14-5-15-10(8)13/h1-5H |
| InChIKey | DCAQCDUVMFFKKE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-bromophenyl)-4,6-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromophenyl)-4,6-dichloropyrimidine?
The IUPAC name of 5-(2-bromophenyl)-4,6-dichloropyrimidine (CID 79439430) is 5-(2-bromophenyl)-4,6-dichloropyrimidine.
What is the SMILES notation for 5-(2-bromophenyl)-4,6-dichloropyrimidine?
The canonical SMILES for 5-(2-bromophenyl)-4,6-dichloropyrimidine is Clc1ncnc(Cl)c1-c1ccccc1Br.
What is the InChIKey of 5-(2-bromophenyl)-4,6-dichloropyrimidine?
The InChIKey is DCAQCDUVMFFKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrCl2N2/c11-7-4-2-1-3-6(7)8-9(12)14-5-15-10(8)13/h1-5H.
What are the key properties of 5-(2-bromophenyl)-4,6-dichloropyrimidine?
5-(2-bromophenyl)-4,6-dichloropyrimidine has a molecular weight of 303.97 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromophenyl)-4,6-dichloropyrimidine is sourced from PubChem (CID 79439430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).