About 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine
3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine (PubChem CID 79439665) has the molecular formula C17H16Cl3N
and a molecular weight of 340.68 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine |
| PubChem CID | 79439665 |
| Molecular Formula | C17H16Cl3N |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine |
| SMILES | Clc1cc(Cl)cc(C2CCNCC2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H16Cl3N/c18-12-7-11(8-13(19)9-12)14-5-6-21-10-16(14)15-3-1-2-4-17(15)20/h1-4,7-9,14,16,21H,5-6,10H2 |
| InChIKey | ANVOBGHUSLLHLN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine?
The IUPAC name of 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine (CID 79439665) is 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine.
What is the SMILES notation for 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine?
The canonical SMILES for 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine is Clc1cc(Cl)cc(C2CCNCC2c2ccccc2Cl)c1.
What is the InChIKey of 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine?
The InChIKey is ANVOBGHUSLLHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl3N/c18-12-7-11(8-13(19)9-12)14-5-6-21-10-16(14)15-3-1-2-4-17(15)20/h1-4,7-9,14,16,21H,5-6,10H2.
What are the key properties of 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine?
3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine has a molecular weight of 340.68 g/mol, XLogP of 5.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-4-(3,5-dichlorophenyl)piperidine is sourced from PubChem (CID 79439665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).