C17H28FN — CID 79440359
2-(3-fluorophenyl)-4-methyl-N-(2-methylpropyl)hexan-1-amine (PubChem CID 79440359) has the molecular formula C17H28FN and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-methyl-N-(2-methylpropyl)hexan-1-amine.
| Compound Name | 2-(3-fluorophenyl)-4-methyl-N-(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 79440359 |
| Molecular Formula | C17H28FN |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-(3-fluorophenyl)-4-methyl-N-(2-methylpropyl)hexan-1-amine |
| SMILES | CCC(C)CC(CNCC(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C17H28FN/c1-5-14(4)9-16(12-19-11-13(2)3)15-7-6-8-17(18)10-15/h6-8,10,13-14,16,19H,5,9,11-12H2,1-4H3 |
| InChIKey | UALDUWHVPYVAPZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |