C16H20FNS — CID 79440969
2-(3-fluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 79440969) has the molecular formula C16H20FNS and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 2-(3-fluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 79440969 |
| Molecular Formula | C16H20FNS |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(3-fluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCCNCC(Cc1cccs1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H20FNS/c1-2-8-18-12-14(11-16-7-4-9-19-16)13-5-3-6-15(17)10-13/h3-7,9-10,14,18H,2,8,11-12H2,1H3 |
| InChIKey | BPVDCJODLMUFRJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|