C16H24BrN — CID 79443132
N-[2-(3-bromophenyl)-5-methylhexyl]cyclopropanamine (PubChem CID 79443132) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-5-methylhexyl]cyclopropanamine.
| Compound Name | N-[2-(3-bromophenyl)-5-methylhexyl]cyclopropanamine |
|---|---|
| PubChem CID | 79443132 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-(3-bromophenyl)-5-methylhexyl]cyclopropanamine |
| SMILES | CC(C)CCC(CNC1CC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H24BrN/c1-12(2)6-7-14(11-18-16-8-9-16)13-4-3-5-15(17)10-13/h3-5,10,12,14,16,18H,6-9,11H2,1-2H3 |
| InChIKey | RWIINQGRRNXYLX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |