C16H17BrO — CID 79443372
2-(3-bromophenyl)-3-(4-methylphenyl)propan-1-ol (PubChem CID 79443372) has the molecular formula C16H17BrO and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(4-methylphenyl)propan-1-ol.
| Compound Name | 2-(3-bromophenyl)-3-(4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 79443372 |
| Molecular Formula | C16H17BrO |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(3-bromophenyl)-3-(4-methylphenyl)propan-1-ol |
| SMILES | Cc1ccc(CC(CO)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H17BrO/c1-12-5-7-13(8-6-12)9-15(11-18)14-3-2-4-16(17)10-14/h2-8,10,15,18H,9,11H2,1H3 |
| InChIKey | JCTHAFFIOPUAJW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |