About 1,5-di(butan-2-yl)-2,2-diethylpiperazine
1,5-di(butan-2-yl)-2,2-diethylpiperazine (PubChem CID 79445458) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 1,5-di(butan-2-yl)-2,2-diethylpiperazine.
Molecular Properties
| Compound Name | 1,5-di(butan-2-yl)-2,2-diethylpiperazine |
| PubChem CID | 79445458 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 1,5-di(butan-2-yl)-2,2-diethylpiperazine |
| SMILES | CCC(C)C1CN(C(C)CC)C(CC)(CC)CN1 |
| InChI | InChI=1S/C16H34N2/c1-7-13(5)15-11-18(14(6)8-2)16(9-3,10-4)12-17-15/h13-15,17H,7-12H2,1-6H3 |
| InChIKey | JWCHCSLSJKDYCV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-di(butan-2-yl)-2,2-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-di(butan-2-yl)-2,2-diethylpiperazine?
The IUPAC name of 1,5-di(butan-2-yl)-2,2-diethylpiperazine (CID 79445458) is 1,5-di(butan-2-yl)-2,2-diethylpiperazine.
What is the SMILES notation for 1,5-di(butan-2-yl)-2,2-diethylpiperazine?
The canonical SMILES for 1,5-di(butan-2-yl)-2,2-diethylpiperazine is CCC(C)C1CN(C(C)CC)C(CC)(CC)CN1.
What is the InChIKey of 1,5-di(butan-2-yl)-2,2-diethylpiperazine?
The InChIKey is JWCHCSLSJKDYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2/c1-7-13(5)15-11-18(14(6)8-2)16(9-3,10-4)12-17-15/h13-15,17H,7-12H2,1-6H3.
What are the key properties of 1,5-di(butan-2-yl)-2,2-diethylpiperazine?
1,5-di(butan-2-yl)-2,2-diethylpiperazine has a molecular weight of 254.46 g/mol, XLogP of 3.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-di(butan-2-yl)-2,2-diethylpiperazine is sourced from PubChem (CID 79445458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).