C13H19Br3N2O2S — CID 79445524
3-[1,3-dibromo-2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79445524) has the molecular formula C13H19Br3N2O2S and a molecular weight of 507.09 g/mol. Its IUPAC name is 3-[1,3-dibromo-2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1,3-dibromo-2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79445524 |
| Molecular Formula | C13H19Br3N2O2S |
| Molecular Weight | 507.09 g/mol |
| Exact Mass | 503.87 |
| IUPAC Name | 3-[1,3-dibromo-2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]propan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cc1nn(C)c(CC(CBr)(CBr)C2CCS(=O)(=O)C2)c1Br |
| InChI | InChI=1S/C13H19Br3N2O2S/c1-9-12(16)11(18(2)17-9)5-13(7-14,8-15)10-3-4-21(19,20)6-10/h10H,3-8H2,1-2H3 |
| InChIKey | OJJZCCJOWRWYPW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|