C14H18BrF3O3 — CID 79445713
2-(2-bromophenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diol (PubChem CID 79445713) has the molecular formula C14H18BrF3O3 and a molecular weight of 371.19 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diol.
| Compound Name | 2-(2-bromophenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79445713 |
| Molecular Formula | C14H18BrF3O3 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-(2-bromophenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diol |
| SMILES | OCC(CO)(CCCOCC(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C14H18BrF3O3/c15-12-5-2-1-4-11(12)13(8-19,9-20)6-3-7-21-10-14(16,17)18/h1-2,4-5,19-20H,3,6-10H2 |
| InChIKey | XETRQHIXJLMPGX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|