C16H17BrO2 — CID 79447171
2-benzyl-2-(3-bromophenyl)propane-1,3-diol (PubChem CID 79447171) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-benzyl-2-(3-bromophenyl)propane-1,3-diol.
| Compound Name | 2-benzyl-2-(3-bromophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79447171 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-benzyl-2-(3-bromophenyl)propane-1,3-diol |
| SMILES | OCC(CO)(Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H17BrO2/c17-15-8-4-7-14(9-15)16(11-18,12-19)10-13-5-2-1-3-6-13/h1-9,18-19H,10-12H2 |
| InChIKey | WTQHJTQOWXEAHT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |