About N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide
N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 7944720) has the molecular formula C17H23F2N3O2S2
and a molecular weight of 403.52 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide |
| PubChem CID | 7944720 |
| Molecular Formula | C17H23F2N3O2S2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(C(=S)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H23F2N3O2S2/c18-14-7-4-8-15(19)16(14)26(23,24)22-11-9-21(10-12-22)17(25)20-13-5-2-1-3-6-13/h4,7-8,13H,1-3,5-6,9-12H2,(H,20,25) |
| InChIKey | BEZHNVLFAUYMKH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide?
The IUPAC name of N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide (CID 7944720) is N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide.
What is the SMILES notation for N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide?
The canonical SMILES for N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide is O=S(=O)(c1c(F)cccc1F)N1CCN(C(=S)NC2CCCCC2)CC1.
What is the InChIKey of N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide?
The InChIKey is BEZHNVLFAUYMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2N3O2S2/c18-14-7-4-8-15(19)16(14)26(23,24)22-11-9-21(10-12-22)17(25)20-13-5-2-1-3-6-13/h4,7-8,13H,1-3,5-6,9-12H2,(H,20,25).
What are the key properties of N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide?
N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide has a molecular weight of 403.52 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide is sourced from PubChem (CID 7944720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).