C14H21FO2 — CID 79449979
2-(3-fluorophenyl)-2-pentylpropane-1,3-diol (PubChem CID 79449979) has the molecular formula C14H21FO2 and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-pentylpropane-1,3-diol.
| Compound Name | 2-(3-fluorophenyl)-2-pentylpropane-1,3-diol |
|---|---|
| PubChem CID | 79449979 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(3-fluorophenyl)-2-pentylpropane-1,3-diol |
| SMILES | CCCCCC(CO)(CO)c1cccc(F)c1 |
| InChI | InChI=1S/C14H21FO2/c1-2-3-4-8-14(10-16,11-17)12-6-5-7-13(15)9-12/h5-7,9,16-17H,2-4,8,10-11H2,1H3 |
| InChIKey | OJYQIMVHQOTRLS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|