C11H24O4S — CID 79450281
2-(3-ethylsulfonylpropyl)-2-propylpropane-1,3-diol (PubChem CID 79450281) has the molecular formula C11H24O4S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropyl)-2-propylpropane-1,3-diol.
| Compound Name | 2-(3-ethylsulfonylpropyl)-2-propylpropane-1,3-diol |
|---|---|
| PubChem CID | 79450281 |
| Molecular Formula | C11H24O4S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(3-ethylsulfonylpropyl)-2-propylpropane-1,3-diol |
| SMILES | CCCC(CO)(CO)CCCS(=O)(=O)CC |
| InChI | InChI=1S/C11H24O4S/c1-3-6-11(9-12,10-13)7-5-8-16(14,15)4-2/h12-13H,3-10H2,1-2H3 |
| InChIKey | RAFSSIJCYALKNS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |