C15H23BrO3 — CID 79450543
2-[2-(3-bromophenoxy)ethyl]-2-(2-methylpropyl)propane-1,3-diol (PubChem CID 79450543) has the molecular formula C15H23BrO3 and a molecular weight of 331.25 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethyl]-2-(2-methylpropyl)propane-1,3-diol.
| Compound Name | 2-[2-(3-bromophenoxy)ethyl]-2-(2-methylpropyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450543 |
| Molecular Formula | C15H23BrO3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethyl]-2-(2-methylpropyl)propane-1,3-diol |
| SMILES | CC(C)CC(CO)(CO)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C15H23BrO3/c1-12(2)9-15(10-17,11-18)6-7-19-14-5-3-4-13(16)8-14/h3-5,8,12,17-18H,6-7,9-11H2,1-2H3 |
| InChIKey | JKDSWLJGQOIMHQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |