C17H19ClO2 — CID 79450583
2-(4-chlorophenyl)-2-[(3-methylphenyl)methyl]propane-1,3-diol (PubChem CID 79450583) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[(3-methylphenyl)methyl]propane-1,3-diol.
| Compound Name | 2-(4-chlorophenyl)-2-[(3-methylphenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79450583 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[(3-methylphenyl)methyl]propane-1,3-diol |
| SMILES | Cc1cccc(CC(CO)(CO)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H19ClO2/c1-13-3-2-4-14(9-13)10-17(11-19,12-20)15-5-7-16(18)8-6-15/h2-9,19-20H,10-12H2,1H3 |
| InChIKey | ITWSYKJOMWXVNF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |