C12H15F2N — CID 79451763
3-[(2,4-difluorophenyl)methyl]-3-ethylazetidine (PubChem CID 79451763) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-3-ethylazetidine.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-3-ethylazetidine |
|---|---|
| PubChem CID | 79451763 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-3-ethylazetidine |
| SMILES | CCC1(Cc2ccc(F)cc2F)CNC1 |
| InChI | InChI=1S/C12H15F2N/c1-2-12(7-15-8-12)6-9-3-4-10(13)5-11(9)14/h3-5,15H,2,6-8H2,1H3 |
| InChIKey | MCWDRHJMDBCZFW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |