C14H26N2O2 — CID 79451893
1-butan-2-yl-3-tert-butyl-6,6-dimethylpiperazine-2,5-dione (PubChem CID 79451893) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-butan-2-yl-3-tert-butyl-6,6-dimethylpiperazine-2,5-dione.
| Compound Name | 1-butan-2-yl-3-tert-butyl-6,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79451893 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-butan-2-yl-3-tert-butyl-6,6-dimethylpiperazine-2,5-dione |
| SMILES | CCC(C)N1C(=O)C(C(C)(C)C)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-8-9(2)16-11(17)10(13(3,4)5)15-12(18)14(16,6)7/h9-10H,8H2,1-7H3,(H,15,18) |
| InChIKey | XJAOZULGJQUATO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |