C16H15Cl2F — CID 79453237
1-(2-benzyl-1,3-dichloropropan-2-yl)-3-fluorobenzene (PubChem CID 79453237) has the molecular formula C16H15Cl2F and a molecular weight of 297.20 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dichloropropan-2-yl)-3-fluorobenzene.
| Compound Name | 1-(2-benzyl-1,3-dichloropropan-2-yl)-3-fluorobenzene |
|---|---|
| PubChem CID | 79453237 |
| Molecular Formula | C16H15Cl2F |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(2-benzyl-1,3-dichloropropan-2-yl)-3-fluorobenzene |
| SMILES | Fc1cccc(C(CCl)(CCl)Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H15Cl2F/c17-11-16(12-18,10-13-5-2-1-3-6-13)14-7-4-8-15(19)9-14/h1-9H,10-12H2 |
| InChIKey | UOOHPHXJUUHHCY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|