C14H19Br2F — CID 79453288
1-[2,2-bis(bromomethyl)-4-methylpentyl]-2-fluorobenzene (PubChem CID 79453288) has the molecular formula C14H19Br2F and a molecular weight of 366.11 g/mol. Its IUPAC name is 1-[2,2-bis(bromomethyl)-4-methylpentyl]-2-fluorobenzene.
| Compound Name | 1-[2,2-bis(bromomethyl)-4-methylpentyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 79453288 |
| Molecular Formula | C14H19Br2F |
| Molecular Weight | 366.11 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 1-[2,2-bis(bromomethyl)-4-methylpentyl]-2-fluorobenzene |
| SMILES | CC(C)CC(CBr)(CBr)Cc1ccccc1F |
| InChI | InChI=1S/C14H19Br2F/c1-11(2)7-14(9-15,10-16)8-12-5-3-4-6-13(12)17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | QWMDMTBBDGCVMU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.11 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|