C10H10Br2F2 — CID 79453351
2-[3-bromo-2-(bromomethyl)propyl]-1,4-difluorobenzene (PubChem CID 79453351) has the molecular formula C10H10Br2F2 and a molecular weight of 327.99 g/mol. Its IUPAC name is 2-[3-bromo-2-(bromomethyl)propyl]-1,4-difluorobenzene.
| Compound Name | 2-[3-bromo-2-(bromomethyl)propyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 79453351 |
| Molecular Formula | C10H10Br2F2 |
| Molecular Weight | 327.99 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 2-[3-bromo-2-(bromomethyl)propyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(CC(CBr)CBr)c1 |
| InChI | InChI=1S/C10H10Br2F2/c11-5-7(6-12)3-8-4-9(13)1-2-10(8)14/h1-2,4,7H,3,5-6H2 |
| InChIKey | SHGLEEWDQVGHGK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|