C11H17Br2N3O2S — CID 79453443
3-[1-bromo-2-(bromomethyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79453443) has the molecular formula C11H17Br2N3O2S and a molecular weight of 415.15 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79453443 |
| Molecular Formula | C11H17Br2N3O2S |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cn1ncnc1CC(CBr)(CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17Br2N3O2S/c1-16-10(14-8-15-16)4-11(6-12,7-13)9-2-3-19(17,18)5-9/h8-9H,2-7H2,1H3 |
| InChIKey | ZQQYCBZQCPIENX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|