C14H15Cl3N2 — CID 79453666
4-[3-chloro-2-(chloromethyl)-2-(3-chlorophenyl)propyl]-1-methylpyrazole (PubChem CID 79453666) has the molecular formula C14H15Cl3N2 and a molecular weight of 317.65 g/mol. Its IUPAC name is 4-[3-chloro-2-(chloromethyl)-2-(3-chlorophenyl)propyl]-1-methylpyrazole.
| Compound Name | 4-[3-chloro-2-(chloromethyl)-2-(3-chlorophenyl)propyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 79453666 |
| Molecular Formula | C14H15Cl3N2 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-[3-chloro-2-(chloromethyl)-2-(3-chlorophenyl)propyl]-1-methylpyrazole |
| SMILES | Cn1cc(CC(CCl)(CCl)c2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C14H15Cl3N2/c1-19-8-11(7-18-19)6-14(9-15,10-16)12-3-2-4-13(17)5-12/h2-5,7-8H,6,9-10H2,1H3 |
| InChIKey | UQSIRHSNKRKXDV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|