C19H22ClNO — CID 7945468
(2R)-2-(4-chlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]butanamide (PubChem CID 7945468) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 7945468 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]butanamide |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](C)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO/c1-13(2)18(16-9-11-17(20)12-10-16)19(22)21-14(3)15-7-5-4-6-8-15/h4-14,18H,1-3H3,(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | JLPMIXQPQVBUMY-KBXCAEBGSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |