C15H12Cl4 — CID 79454700
1,2-dichloro-4-[3-chloro-2-(2-chlorophenyl)propyl]benzene (PubChem CID 79454700) has the molecular formula C15H12Cl4 and a molecular weight of 334.07 g/mol. Its IUPAC name is 1,2-dichloro-4-[3-chloro-2-(2-chlorophenyl)propyl]benzene.
| Compound Name | 1,2-dichloro-4-[3-chloro-2-(2-chlorophenyl)propyl]benzene |
|---|---|
| PubChem CID | 79454700 |
| Molecular Formula | C15H12Cl4 |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1,2-dichloro-4-[3-chloro-2-(2-chlorophenyl)propyl]benzene |
| SMILES | ClCC(Cc1ccc(Cl)c(Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl4/c16-9-11(12-3-1-2-4-13(12)17)7-10-5-6-14(18)15(19)8-10/h1-6,8,11H,7,9H2 |
| InChIKey | YGOYIBZOXLWABR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|