C15H16Br3NS — CID 79456011
5-[4-bromo-3-(bromomethyl)-3-(3-bromophenyl)butyl]-4-methyl-1,3-thiazole (PubChem CID 79456011) has the molecular formula C15H16Br3NS and a molecular weight of 482.08 g/mol. Its IUPAC name is 5-[4-bromo-3-(bromomethyl)-3-(3-bromophenyl)butyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[4-bromo-3-(bromomethyl)-3-(3-bromophenyl)butyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79456011 |
| Molecular Formula | C15H16Br3NS |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 478.86 |
| IUPAC Name | 5-[4-bromo-3-(bromomethyl)-3-(3-bromophenyl)butyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCC(CBr)(CBr)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16Br3NS/c1-11-14(20-10-19-11)5-6-15(8-16,9-17)12-3-2-4-13(18)7-12/h2-4,7,10H,5-6,8-9H2,1H3 |
| InChIKey | YCCJAZWYJBADEK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|