C12H15NO5 — CID 79456992
2-[2-[(2-hydroxy-5-methylbenzoyl)amino]ethoxy]acetic acid (PubChem CID 79456992) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-5-methylbenzoyl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-hydroxy-5-methylbenzoyl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79456992 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[2-[(2-hydroxy-5-methylbenzoyl)amino]ethoxy]acetic acid |
| SMILES | Cc1ccc(O)c(C(=O)NCCOCC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO5/c1-8-2-3-10(14)9(6-8)12(17)13-4-5-18-7-11(15)16/h2-3,6,14H,4-5,7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | GNMAVNZHLNCNRR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|