C11H22N2O4 — CID 79457124
2-[2-[(3-amino-2,2,3-trimethylbutanoyl)amino]ethoxy]acetic acid (PubChem CID 79457124) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[2-[(3-amino-2,2,3-trimethylbutanoyl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3-amino-2,2,3-trimethylbutanoyl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457124 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[2-[(3-amino-2,2,3-trimethylbutanoyl)amino]ethoxy]acetic acid |
| SMILES | CC(C)(N)C(C)(C)C(=O)NCCOCC(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-10(2,11(3,4)12)9(16)13-5-6-17-7-8(14)15/h5-7,12H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | MUXCMTNHJMYCKD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|