C12H18N2O5S — CID 79457379
2-[2-[4-(ethylsulfamoyl)anilino]ethoxy]acetic acid (PubChem CID 79457379) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[2-[4-(ethylsulfamoyl)anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-(ethylsulfamoyl)anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457379 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[2-[4-(ethylsulfamoyl)anilino]ethoxy]acetic acid |
| SMILES | CCNS(=O)(=O)c1ccc(NCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-2-14-20(17,18)11-5-3-10(4-6-11)13-7-8-19-9-12(15)16/h3-6,13-14H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | ADGIPEUGNKBOLF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|