C14H18BrNO — CID 79458333
(3-bromo-4-methylphenyl)-(2-ethylpyrrolidin-1-yl)methanone (PubChem CID 79458333) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-(2-ethylpyrrolidin-1-yl)methanone.
| Compound Name | (3-bromo-4-methylphenyl)-(2-ethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 79458333 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (3-bromo-4-methylphenyl)-(2-ethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1CCCN1C(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C14H18BrNO/c1-3-12-5-4-8-16(12)14(17)11-7-6-10(2)13(15)9-11/h6-7,9,12H,3-5,8H2,1-2H3 |
| InChIKey | AHLVZNFCPOXBNN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |