C15H30N2O — CID 79458447
1-N-(3-cyclohexyloxypropyl)cyclohexane-1,3-diamine (PubChem CID 79458447) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-N-(3-cyclohexyloxypropyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(3-cyclohexyloxypropyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458447 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-N-(3-cyclohexyloxypropyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(NCCCOC2CCCCC2)C1 |
| InChI | InChI=1S/C15H30N2O/c16-13-6-4-7-14(12-13)17-10-5-11-18-15-8-2-1-3-9-15/h13-15,17H,1-12,16H2 |
| InChIKey | JSWQEPXNAAYCND-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|