About 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine
1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 79458882) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine |
| PubChem CID | 79458882 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(NCCc2cscn2)C1 |
| InChI | InChI=1S/C11H19N3S/c12-9-2-1-3-10(6-9)13-5-4-11-7-15-8-14-11/h7-10,13H,1-6,12H2 |
| InChIKey | ZDZOLYWIWZPYJW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine?
The IUPAC name of 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine (CID 79458882) is 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine.
What is the SMILES notation for 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine?
The canonical SMILES for 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine is NC1CCCC(NCCc2cscn2)C1.
What is the InChIKey of 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine?
The InChIKey is ZDZOLYWIWZPYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c12-9-2-1-3-10(6-9)13-5-4-11-7-15-8-14-11/h7-10,13H,1-6,12H2.
What are the key properties of 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine?
1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine has a molecular weight of 225.36 g/mol, XLogP of 1.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[2-(1,3-thiazol-4-yl)ethyl]cyclohexane-1,3-diamine is sourced from PubChem (CID 79458882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).