C16H14Cl2FN — CID 79460976
3-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)azetidine (PubChem CID 79460976) has the molecular formula C16H14Cl2FN and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)azetidine.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)azetidine |
|---|---|
| PubChem CID | 79460976 |
| Molecular Formula | C16H14Cl2FN |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)azetidine |
| SMILES | Fc1ccc(C2(Cc3ccc(Cl)cc3Cl)CNC2)cc1 |
| InChI | InChI=1S/C16H14Cl2FN/c17-13-4-1-11(15(18)7-13)8-16(9-20-10-16)12-2-5-14(19)6-3-12/h1-7,20H,8-10H2 |
| InChIKey | LONIAIYYGOCRMF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |