About 2-[(3-aminocyclopentyl)amino]propane-1,3-diol
2-[(3-aminocyclopentyl)amino]propane-1,3-diol (PubChem CID 79461491) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-[(3-aminocyclopentyl)amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(3-aminocyclopentyl)amino]propane-1,3-diol |
| PubChem CID | 79461491 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-[(3-aminocyclopentyl)amino]propane-1,3-diol |
| SMILES | NC1CCC(NC(CO)CO)C1 |
| InChI | InChI=1S/C8H18N2O2/c9-6-1-2-7(3-6)10-8(4-11)5-12/h6-8,10-12H,1-5,9H2 |
| InChIKey | XJRZSHYPPQPQIQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3-aminocyclopentyl)amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-aminocyclopentyl)amino]propane-1,3-diol?
The IUPAC name of 2-[(3-aminocyclopentyl)amino]propane-1,3-diol (CID 79461491) is 2-[(3-aminocyclopentyl)amino]propane-1,3-diol.
What is the SMILES notation for 2-[(3-aminocyclopentyl)amino]propane-1,3-diol?
The canonical SMILES for 2-[(3-aminocyclopentyl)amino]propane-1,3-diol is NC1CCC(NC(CO)CO)C1.
What is the InChIKey of 2-[(3-aminocyclopentyl)amino]propane-1,3-diol?
The InChIKey is XJRZSHYPPQPQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c9-6-1-2-7(3-6)10-8(4-11)5-12/h6-8,10-12H,1-5,9H2.
What are the key properties of 2-[(3-aminocyclopentyl)amino]propane-1,3-diol?
2-[(3-aminocyclopentyl)amino]propane-1,3-diol has a molecular weight of 174.24 g/mol, XLogP of -1.19, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-aminocyclopentyl)amino]propane-1,3-diol is sourced from PubChem (CID 79461491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).