C11H18N2O — CID 79462115
3-N-[2-(furan-2-yl)ethyl]cyclopentane-1,3-diamine (PubChem CID 79462115) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-N-[2-(furan-2-yl)ethyl]cyclopentane-1,3-diamine.
| Compound Name | 3-N-[2-(furan-2-yl)ethyl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79462115 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-N-[2-(furan-2-yl)ethyl]cyclopentane-1,3-diamine |
| SMILES | NC1CCC(NCCc2ccco2)C1 |
| InChI | InChI=1S/C11H18N2O/c12-9-3-4-10(8-9)13-6-5-11-2-1-7-14-11/h1-2,7,9-10,13H,3-6,8,12H2 |
| InChIKey | CWFHQMXLSUWUMA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |