C11H21N3O — CID 79462547
3-[(3-aminocyclopentyl)amino]-N-cyclopropylpropanamide (PubChem CID 79462547) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-[(3-aminocyclopentyl)amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(3-aminocyclopentyl)amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 79462547 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-[(3-aminocyclopentyl)amino]-N-cyclopropylpropanamide |
| SMILES | NC1CCC(NCCC(=O)NC2CC2)C1 |
| InChI | InChI=1S/C11H21N3O/c12-8-1-2-10(7-8)13-6-5-11(15)14-9-3-4-9/h8-10,13H,1-7,12H2,(H,14,15) |
| InChIKey | RTSRABLKKXPCTC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |