C26H26NO4- — CID 7946339
(4E)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 7946339) has the molecular formula C26H26NO4- and a molecular weight of 416.50 g/mol. Its IUPAC name is (4E)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | (4E)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 7946339 |
| Molecular Formula | C26H26NO4- |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (4E)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CCCCOc1ccc(/C=C2\CCCc3c2nc2ccccc2c3C(=O)[O-])cc1OC |
| InChI | InChI=1S/C26H27NO4/c1-3-4-14-31-22-13-12-17(16-23(22)30-2)15-18-8-7-10-20-24(26(28)29)19-9-5-6-11-21(19)27-25(18)20/h5-6,9,11-13,15-16H,3-4,7-8,10,14H2,1-2H3,(H,28,29)/p-1/b18-15+ |
| InChIKey | AIWIJKVTKKVPCN-OBGWFSINSA-M |
| XLogP | 4.66 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|