C12H15N3O5 — CID 79463712
2-[2-[(4-carbamoylphenyl)carbamoylamino]ethoxy]acetic acid (PubChem CID 79463712) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[2-[(4-carbamoylphenyl)carbamoylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(4-carbamoylphenyl)carbamoylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463712 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[2-[(4-carbamoylphenyl)carbamoylamino]ethoxy]acetic acid |
| SMILES | NC(=O)c1ccc(NC(=O)NCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C12H15N3O5/c13-11(18)8-1-3-9(4-2-8)15-12(19)14-5-6-20-7-10(16)17/h1-4H,5-7H2,(H2,13,18)(H,16,17)(H2,14,15,19) |
| InChIKey | IBQWCOMCDYZVHM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|