C12H14BrN3O2S — CID 79464456
2-[[3-[(2-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methoxy]ethanamine (PubChem CID 79464456) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is 2-[[3-[(2-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methoxy]ethanamine.
| Compound Name | 2-[[3-[(2-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 79464456 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-[[3-[(2-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methoxy]ethanamine |
| SMILES | NCCOCc1nc(CSc2ccccc2Br)no1 |
| InChI | InChI=1S/C12H14BrN3O2S/c13-9-3-1-2-4-10(9)19-8-11-15-12(18-16-11)7-17-6-5-14/h1-4H,5-8,14H2 |
| InChIKey | XVTPZDTYVWQDDK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|