C12H15NO5S — CID 79465235
methyl 4-(4-methoxythiophene-2-carbonyl)morpholine-2-carboxylate (PubChem CID 79465235) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 4-(4-methoxythiophene-2-carbonyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(4-methoxythiophene-2-carbonyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 79465235 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 4-(4-methoxythiophene-2-carbonyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2cc(OC)cs2)CCO1 |
| InChI | InChI=1S/C12H15NO5S/c1-16-8-5-10(19-7-8)11(14)13-3-4-18-9(6-13)12(15)17-2/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | NNUQUBKHCKMFQK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |