About 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine
3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine (PubChem CID 79465579) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine |
| PubChem CID | 79465579 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine |
| SMILES | NC1CCC(OC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C9H17NO3S/c10-7-1-2-8(5-7)13-9-3-4-14(11,12)6-9/h7-9H,1-6,10H2 |
| InChIKey | IENZJAJTBZZNHN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine (CID 79465579) is 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine is NC1CCC(OC2CCS(=O)(=O)C2)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine?
The InChIKey is IENZJAJTBZZNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3S/c10-7-1-2-8(5-7)13-9-3-4-14(11,12)6-9/h7-9H,1-6,10H2.
What are the key properties of 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine?
3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine has a molecular weight of 219.31 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)oxycyclopentan-1-amine is sourced from PubChem (CID 79465579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).