C9H12F3N3O2S — CID 79466601
2-amino-4-[methyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide (PubChem CID 79466601) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-amino-4-[methyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide.
| Compound Name | 2-amino-4-[methyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79466601 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-amino-4-[methyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)c1ccc(S(N)(=O)=O)c(N)c1 |
| InChI | InChI=1S/C9H12F3N3O2S/c1-15(5-9(10,11)12)6-2-3-8(7(13)4-6)18(14,16)17/h2-4H,5,13H2,1H3,(H2,14,16,17) |
| InChIKey | YWAOXIMUVPYCKA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|