About (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile
(Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 794674) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile |
| PubChem CID | 794674 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2O5/c1-23-14-6-4-12(5-7-14)8-13(11-19)15-9-17(24-2)18(25-3)10-16(15)20(21)22/h4-10H,1-3H3/b13-8+ |
| InChIKey | URHIFQZQJIHIJE-MDWZMJQESA-N |
| XLogP | 3.68 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The IUPAC name of (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile (CID 794674) is (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile.
What is the SMILES notation for (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The canonical SMILES for (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile is COc1ccc(/C=C(\C#N)c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1.
What is the InChIKey of (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The InChIKey is URHIFQZQJIHIJE-MDWZMJQESA-N. The full InChI is InChI=1S/C18H16N2O5/c1-23-14-6-4-12(5-7-14)8-13(11-19)15-9-17(24-2)18(25-3)10-16(15)20(21)22/h4-10H,1-3H3/b13-8+.
What are the key properties of (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
(Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile has a molecular weight of 340.34 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(4,5-dimethoxy-2-nitrophenyl)-3-(4-methoxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 794674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).