C17H34N2 — CID 79470156
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2-methylbutan-1-amine (PubChem CID 79470156) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2-methylbutan-1-amine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 79470156 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2-methylbutan-1-amine |
| SMILES | CCC(C)CN(CC)CC1CCC2CCCCC2N1 |
| InChI | InChI=1S/C17H34N2/c1-4-14(3)12-19(5-2)13-16-11-10-15-8-6-7-9-17(15)18-16/h14-18H,4-13H2,1-3H3 |
| InChIKey | SIYKDYUDKGKMRS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |