About ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate
ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate (PubChem CID 79471172) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate |
| PubChem CID | 79471172 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate |
| SMILES | CCOC(=O)C(c1nncn1C)C(C)C |
| InChI | InChI=1S/C10H17N3O2/c1-5-15-10(14)8(7(2)3)9-12-11-6-13(9)4/h6-8H,5H2,1-4H3 |
| InChIKey | RAADUEVCAXQWFF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate?
The IUPAC name of ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate (CID 79471172) is ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate.
What is the SMILES notation for ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate?
The canonical SMILES for ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate is CCOC(=O)C(c1nncn1C)C(C)C.
What is the InChIKey of ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate?
The InChIKey is RAADUEVCAXQWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-5-15-10(14)8(7(2)3)9-12-11-6-13(9)4/h6-8H,5H2,1-4H3.
What are the key properties of ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate?
ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate has a molecular weight of 211.26 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-2-(4-methyl-1,2,4-triazol-3-yl)butanoate is sourced from PubChem (CID 79471172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).