ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate

C12H21N3O2 — CID 79471211

IUPACethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate
SMILESCCCn1c(C)nnc1C(C)(C)C(=O)OCC
InChIInChI=1S/C12H21N3O2/c1-6-8-15-9(3)13-14-10(15)12(4,5)11(16)17-7-2/h6-8H2,1-5H3
InChIKeyWAWZGBBYPLSBOJ-UHFFFAOYSA-N
MW239.32 g/mol
LogP1.84
Rot. Bonds5

About ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate

ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate (PubChem CID 79471211) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate.

Molecular Properties

Compound Nameethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate
PubChem CID79471211
Molecular FormulaC12H21N3O2
Molecular Weight239.32 g/mol
Exact Mass239.16
IUPAC Nameethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate
SMILESCCCn1c(C)nnc1C(C)(C)C(=O)OCC
InChIInChI=1S/C12H21N3O2/c1-6-8-15-9(3)13-14-10(15)12(4,5)11(16)17-7-2/h6-8H2,1-5H3
InChIKeyWAWZGBBYPLSBOJ-UHFFFAOYSA-N
XLogP1.84
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.32
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate?
The IUPAC name of ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate (CID 79471211) is ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate.
What is the SMILES notation for ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate?
The canonical SMILES for ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate is CCCn1c(C)nnc1C(C)(C)C(=O)OCC.
What is the InChIKey of ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate?
The InChIKey is WAWZGBBYPLSBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-6-8-15-9(3)13-14-10(15)12(4,5)11(16)17-7-2/h6-8H2,1-5H3.
What are the key properties of ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate?
ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate has a molecular weight of 239.32 g/mol, XLogP of 1.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-2-(5-methyl-4-propyl-1,2,4-triazol-3-yl)propanoate is sourced from PubChem (CID 79471211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).