About ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate
ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate (PubChem CID 79471220) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate |
| PubChem CID | 79471220 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC)(CC)c1nncn1CC |
| InChI | InChI=1S/C12H21N3O2/c1-5-12(6-2,11(16)17-8-4)10-14-13-9-15(10)7-3/h9H,5-8H2,1-4H3 |
| InChIKey | SQXMDIZBLKCMBL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate?
The IUPAC name of ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate (CID 79471220) is ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate.
What is the SMILES notation for ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate?
The canonical SMILES for ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate is CCOC(=O)C(CC)(CC)c1nncn1CC.
What is the InChIKey of ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate?
The InChIKey is SQXMDIZBLKCMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-5-12(6-2,11(16)17-8-4)10-14-13-9-15(10)7-3/h9H,5-8H2,1-4H3.
What are the key properties of ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate?
ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate has a molecular weight of 239.32 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethyl-2-(4-ethyl-1,2,4-triazol-3-yl)butanoate is sourced from PubChem (CID 79471220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).